CAS
90725-67-0 Purity
---
90725-67-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C9H18N2O2.
The molecular weight is 186.25 g/mol.
The IUPAC name is ethyl 1,4-dimethylpiperazine-2-carboxylate.
The InChI code is InChI=1S/C9H18N2O2/c1-4-13-9(12)8-7-10(2)5-6-11(8)3/h8H,4-7H2,1-3H3.
There are 4 hydrogen bond acceptor counts.
The topological polar surface area is 32.8 Å2.
Yes, the compound is canonicalized.
The exact mass is 186.136827821 g/mol.
There are 3 rotatable bond counts.
The CAS number is 90729-01-4.