Drospirenone acid potassium salt

CAS

90704-90-8

Catalog Number

ACM90704908

Category

Other Products

Molecular Weight

422.60

Molecular Formula

C₂₄H₃₁KO₄

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

IUPAC Name

Drospirenone Acid Potassium Salt

Canonical SMILES

CC12CCC(=O)C=C1C3CC3C4C2CCC5(C4C6CC6C5(CCC(=O)O)O)C.[K]

InChI Key

XJHWUTVLXZIZND-UHFFFAOYSA-N

Exact Mass

422.18600

What is the PubChem CID for Drospirenone acid potassium salt?

The PubChem CID for Drospirenone acid potassium salt is 46781436.

What is the molecular formula of Drospirenone acid potassium salt?

The molecular formula of Drospirenone acid potassium salt is C24H32KO4.

What is the molecular weight of Drospirenone acid potassium salt?

The molecular weight of Drospirenone acid potassium salt is 423.6 g/mol.

What is the InChI of Drospirenone acid potassium salt?

The InChI of Drospirenone acid potassium salt is InChI=1S/C24H32O4.K/c1-22-6-3-12(25)9-17(22)13-10-14(13)20-16(22)4-7-23(2)21(20)15-11-18(15)24(23,28)8-5-19(26)27;/h9,13-16,18,20-21,28H,3-8,10-11H2,1-2H3,(H,26,27).

What is the InChIKey of Drospirenone acid potassium salt?

The InChIKey of Drospirenone acid potassium salt is XJHWUTVLXZIZND-UHFFFAOYSA-N.

What is the canonical SMILES of Drospirenone acid potassium salt?

The canonical SMILES of Drospirenone acid potassium salt is CC12CCC(=O)C=C1C3CC3C4C2CCC5(C4C6CC6C5(CCC(=O)O)O)C.[K].

What is the CAS number of Drospirenone acid potassium salt?

The CAS number of Drospirenone acid potassium salt is 90704-90-8.

What is the hydrogen bond donor count of Drospirenone acid potassium salt?

The hydrogen bond donor count of Drospirenone acid potassium salt is 2.

What is the hydrogen bond acceptor count of Drospirenone acid potassium salt?

The hydrogen bond acceptor count of Drospirenone acid potassium salt is 4.

Is Drospirenone acid potassium salt a canonicalized compound?

Yes, Drospirenone acid potassium salt is a canonicalized compound.