90-65-3 Purity
Purity >98% (HPLC)
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 5-naphthalen-1-yl-3H-furan-2-one.
The molecular formula of the compound is C14H10O2.
The molecular weight of the compound is 210.23 g/mol.
The InChI of the compound is InChI=1S/C14H10O2/c15-14-9-8-13(16-14)12-7-3-5-10-4-1-2-6-11(10)12/h1-8H,9H2.
The InChIKey of the compound is KSFLWMPJLKCMBH-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1C=C(OC1=O)C2=CC=CC3=CC=CC=C32.
The CAS number of the compound is 906560-16-5.
The hydrogen bond donor count of the compound is 0.
The hydrogen bond acceptor count of the compound is 2.
Yes, the compound is canonicalized.