What is the molecular formula of {4-[5-(Trifluoromethyl)pyrid-2-yl]phenyl}methylamine?
The molecular formula is C13H11F3N2.
What is the molecular weight of {4-[5-(Trifluoromethyl)pyrid-2-yl]phenyl}methylamine?
The molecular weight is 252.23 g/mol.
What is the IUPAC name of {4-[5-(Trifluoromethyl)pyrid-2-yl]phenyl}methylamine?
The IUPAC name is [4-[5-(trifluoromethyl)pyridin-2-yl]phenyl]methanamine.
What is the InChI of {4-[5-(Trifluoromethyl)pyrid-2-yl]phenyl}methylamine?
The InChI is InChI=1S/C13H11F3N2/c14-13(15,16)11-5-6-12(18-8-11)10-3-1-9(7-17)2-4-10/h1-6,8H,7,17H2.
What is the InChIKey of {4-[5-(Trifluoromethyl)pyrid-2-yl]phenyl}methylamine?
The InChIKey is XQAJYHFQYZEWSE-UHFFFAOYSA-N.
What is the Canonical SMILES of {4-[5-(Trifluoromethyl)pyrid-2-yl]phenyl}methylamine?
The Canonical SMILES is C1=CC(=CC=C1CN)C2=NC=C(C=C2)C(F)(F)F.
What is the CAS number of {4-[5-(Trifluoromethyl)pyrid-2-yl]phenyl}methylamine?
The CAS number is 906352-74-7.
How many hydrogen bond donor counts are there in {4-[5-(Trifluoromethyl)pyrid-2-yl]phenyl}methylamine?
There is 1 hydrogen bond donor count.
What is the topological polar surface area of {4-[5-(Trifluoromethyl)pyrid-2-yl]phenyl}methylamine?
The topological polar surface area is 38.9 Ų.
Is {4-[5-(Trifluoromethyl)pyrid-2-yl]phenyl}methylamine a canonicalized compound?
Yes, it is canonicalized according to PubChem.