CAS
90610-69-8 Purity
97%
90610-69-8 Purity
97%
Inquiry Basket
7-Norbornanone,2,3-epoxy-,dimethylacetal(7ci)
CAS
90612-59-2
Catalog Number
ACM90612592
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C9H14O3.
What are some synonyms for the compound?
Some synonyms for the compound include NSC176911, 8,8-Dimethoxy-3-oxatricyclo[3.2.1.0~2,4~]octane, and DTXSID60306479.
When was the compound created and last modified?
The compound was created on 2005-03-26 and last modified on 2023-12-30.
What is the molecular weight of the compound?
The molecular weight of the compound is 170.21 g/mol.
What is the IUPAC name of the compound?
The IUPAC Name of the compound is 8,8-dimethoxy-3-oxatricyclo[3.2.1.0 2,4 ]octane.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H14O3/c1-10-9(11-2)5-3-4-6(9)8-7(5)12-8/h5-8H,3-4H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is XMGXUDFCGKIQBW-UHFFFAOYSA-N.
How many hydrogen bond acceptors are there in the compound?
There are 3 hydrogen bond acceptors in the compound.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 31.2.
Is the compound canonicalized?
Yes, the compound is canonicalized according to PubChem.
Recommended Products
