What is the molecular formula of ethyl 2-piperazine-4-(4-trifluoromethyl)phenyl thiazole-5-carboxylate?
The molecular formula is C17H18F3N3O2S.
When was ethyl 2-piperazine-4-(4-trifluoromethyl)phenyl thiazole-5-carboxylate created?
It was created on May 28, 2009.
What is the IUPAC name of ethyl 2-piperazine-4-(4-trifluoromethyl)phenyl thiazole-5-carboxylate?
The IUPAC name is ethyl 2-piperazin-1-yl-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate.
What is the Canonical SMILES representation of ethyl 2-piperazine-4-(4-trifluoromethyl)phenyl thiazole-5-carboxylate?
The Canonical SMILES is CCOC(=O)C1=C(N=C(S1)N2CCNCC2)C3=CC=C(C=C3)C(F)(F)F.
What is the molecular weight of ethyl 2-piperazine-4-(4-trifluoromethyl)phenyl thiazole-5-carboxylate?
The molecular weight is 385.4 g/mol.
How many hydrogen bond donor counts are there in ethyl 2-piperazine-4-(4-trifluoromethyl)phenyl thiazole-5-carboxylate?
There is 1 hydrogen bond donor count.
What is the XLogP3-AA value of ethyl 2-piperazine-4-(4-trifluoromethyl)phenyl thiazole-5-carboxylate?
The XLogP3-AA value is 3.9.
What is the hydrogen bond acceptor count in ethyl 2-piperazine-4-(4-trifluoromethyl)phenyl thiazole-5-carboxylate?
There are 9 hydrogen bond acceptor counts.
What is the topological polar surface area of ethyl 2-piperazine-4-(4-trifluoromethyl)phenyl thiazole-5-carboxylate?
The topological polar surface area is 82.7 Ų.
Is the compound canonicalized in the PubChem database?
Yes, the compound is canonicalized.