CAS
905807-58-1 Purity
96%
905807-58-1 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C12H10ClNO3.
It was created on 2009-05-28.
The IUPAC Name is methyl 4-chloro-6-methoxyquinoline-2-carboxylate.
The Canonical SMILES is COC1=CC2=C(C=C1)N=C(C=C2Cl)C(=O)OC.
The molecular weight is 251.66 g/mol.
The XLogP3-AA value is 3.
There are 4 hydrogen bond acceptor counts.
The topological polar surface area is 48.4 Ų.
There are 3 rotatable bond counts.
Yes, it is the canonicalized compound.