905716-27-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H7F3N2O3.
The molecular weight of the compound is 272.18 g/mol.
The IUPAC name of the compound is 2-oxo-5-[4-(trifluoromethyl)phenyl]-1,3-dihydroimidazole-4-carboxylic acid.
The InChI of the compound is InChI=1S/C11H7F3N2O3/c12-11(13,14)6-3-1-5(2-4-6)7-8(9(17)18)16-10(19)15-7/h1-4H,(H,17,18)(H2,15,16,19).
The InChIKey of the compound is NSFCXGZBPKYVLC-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1=CC(=CC=C1C2=C(NC(=O)N2)C(=O)O)C(F)(F)F.
There are 3 hydrogen bond donor counts in the compound.
The XLogP3-AA value of the compound is 1.4.
The topological polar surface area of the compound is 78.4 Ų.
Yes, the compound is canonicalized according to PubChem.