CAS
905710-14-7 Purity
---
905710-14-7 Purity
---
Inquiry Basket
ACETAMIDE,N-(1-ETHYL-1,2-DIHYDRO-2-OXO-PYRIMIDIN-4-YL)-
CAS
905716-22-5
Catalog Number
ACM905716225
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-(1-ethyl-2-oxopyrimidin-4-yl)acetamide.
What is the molecular formula of the compound?
The molecular formula of the compound is C8H11N3O2.
What are the synonyms of the compound?
The synonyms of the compound are 905716-22-5 and N-(1-Ethyl-2-oxo-1,2-dihydro-4-pyrimidinyl)acetamide.
What is the molecular weight of the compound?
The molecular weight of the compound is 181.19 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H11N3O2/c1-3-11-5-4-7(9-6(2)12)10-8(11)13/h4-5H,3H2,1-2H3,(H,9,10,12,13).
What is the InChIKey of the compound?
The InChIKey of the compound is OVPDGKPJFCGEDH-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CCN1C=CC(=NC1=O)NC(=O)C.
What is the XLogP3-AA of the compound?
The XLogP3-AA of the compound is -0.6.
How many hydrogen bond donor count does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does the compound have?
The compound has 2 hydrogen bond acceptor count.
Recommended Products
