905706-74-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H6BrNO.
The molecular weight of the compound is 212.04 g/mol.
The compound was created on October 30, 2011.
The IUPAC name of the compound is 4-bromo-3-(hydroxymethyl)benzonitrile.
The InChI of the compound is InChI=1S/C8H6BrNO/c9-8-2-1-6(4-10)3-7(8)5-11/h1-3,11H,5H2.
The InChIKey of the compound is MKEWOMLQLUYQPK-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=C(C=C1C#N)CO)Br.
The CAS number of the compound is 905710-66-9.
The XLogP3 value of the compound is 1.2.
Yes, the compound is canonicalized.