CAS
90557-83-8 Purity
---
90557-83-8 Purity
---
Inquiry Basket
ACETAMIDE,N-[1-(5-FLUORO-PYRIMIDIN-2-YL)VINYL]-
CAS
905587-32-8
Catalog Number
ACM905587328
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C8H8FN3O.
What is the molecular weight of the compound?
The molecular weight of the compound is 181.17 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-[1-(5-fluoropyrimidin-2-yl)ethenyl]acetamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H8FN3O/c1-5(12-6(2)13)8-10-3-7(9)4-11-8/h3-4H,1H2,2H3,(H,12,13).
What is the InChIKey of the compound?
The InChIKey of the compound is OGRMNTHNSGWGGX-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(=O)NC(=C)C1=NC=C(C=N1)F.
What is the CAS number of the compound?
The CAS number of the compound is 905587-32-8.
What is the EC number of the compound?
The EC number of the compound is 621-330-7.
What is the DSSTox Substance ID of the compound?
The DSSTox Substance ID of the compound is DTXSID50668896.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![Benzoic acid,2-[(aminoacetyl)amino]-(9ci)](https://resource.alfa-chemistry.com/structure/90557-83-8.gif)
![2,3-Dihydro-benzo[1,4]dioxine-2-carboxylic acid hydrazide](https://resource.alfa-chemistry.com/structure/90557-92-9.gif)
CAS
90557-92-9 Purity
96%
90557-92-9 Purity
96%
