905560-36-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H13N3O.
The IUPAC name of the compound is 4-methyl-6-propan-2-yloxypyrimidin-2-amine.
The InChI of the compound is InChI=1S/C8H13N3O/c1-5(2)12-7-4-6(3)10-8(9)11-7/h4-5H,1-3H3,(H2,9,10,11).
The InChIKey of the compound is SGSMTBSMVGCSHB-UHFFFAOYSA-N.
The molecular weight of the compound is 167.21 g/mol.
The XLogP3-AA value of the compound is 1.4.
The compound has 1 hydrogen bond donor count.
The compound has 4 hydrogen bond acceptor counts.
The compound has 2 rotatable bond counts.
Yes, the compound is canonicalized.