90521-82-7 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H18N2O.
The molecular weight of the compound is 206.28 g/mol.
The IUPAC name of the compound is 3-amino-N-tert-butyl-2-methylbenzamide.
The Canonical SMILES notation of the compound is CC1=C(C=CC=C1N)C(=O)NC(C)(C)C.
The InChI of the compound is InChI=1S/C12H18N2O/c1-8-9(6-5-7-10(8)13)11(15)14-12(2,3)4/h5-7H,13H2,1-4H3,(H,14,15).
The InChIKey of the compound is IXEWVCCLFLNMKU-UHFFFAOYSA-N.
The compound has 2 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 55.1 2.
Yes, the compound is canonicalized.