904817-23-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C15H15N3O2.
The compound was created on July 19, 2005.
The molecular weight of the compound is 269.30 g/mol.
The IUPAC name of the compound is 6-(2-pyridin-2-ylpyrrolidin-1-yl)pyridine-3-carboxylic acid.
The Canonical SMILES of the compound is C1CC(N(C1)C2=NC=C(C=C2)C(=O)O)C3=CC=CC=N3.
The compound has 1 hydrogen bond donor count.
The XLogP3-AA value of the compound is 1.8.
The topological polar surface area of the compound is 66.3 ?2.
No, the compound does not have any defined atom stereocenter count.
Yes, the compound is canonicalized.