904816-83-7 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C15H15N3O2.
The molecular weight of the compound is 269.30 g/mol.
The IUPAC name of the compound is 2-(2-pyridin-4-ylpyrrolidin-1-yl)pyridine-3-carboxylic acid.
The Canonical SMILES representation of the compound is C1CC(N(C1)C2=C(C=CC=N2)C(=O)O)C3=CC=NC=C3.
The InChIKey of the compound is RHSGINWTCHBMKO-UHFFFAOYSA-N.
The XLogP3-AA value of the compound is 1.8.
The compound has 1 hydrogen bond donor count.
The compound has 5 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 66.3 Ų.
Yes, the compound is canonicalized.