What is the molecular formula of Benzoic acid, 2-(4-morpholinylmethyl)-, lithium salt(1:1)?
The molecular formula is C12H14LiNO3.
What are some synonyms for Benzoic acid, 2-(4-morpholinylmethyl)-, lithium salt(1:1)?
Some synonyms include lithium 2-[(morpholin-4-yl)methyl]benzoate and lithium 2-(morpholinomethyl)benzoate.
When was Benzoic acid, 2-(4-morpholinylmethyl)-, lithium salt(1:1) created and modified?
It was created on 2008-02-05 and modified on 2023-12-30.
What is the IUPAC name of Benzoic acid, 2-(4-morpholinylmethyl)-, lithium salt(1:1)?
The IUPAC name is lithium;2-(morpholin-4-ylmethyl)benzoate.
What is the InChI of Benzoic acid, 2-(4-morpholinylmethyl)-, lithium salt(1:1)?
The InChI is InChI=1S/C12H15NO3.Li/c14-12(15)11-4-2-1-3-10(11)9-13-5-7-16-8-6-13;/h1-4H,5-9H2,(H,14,15);/q;+1/p-1.
What is the Canonical SMILES representation of Benzoic acid, 2-(4-morpholinylmethyl)-, lithium salt(1:1)?
The Canonical SMILES is [Li+].C1COCCN1CC2=CC=CC=C2C(=O)[O-].
What is the molecular weight of Benzoic acid, 2-(4-morpholinylmethyl)-, lithium salt(1:1)?
The molecular weight is 227.2 g/mol.
How many hydrogen bond acceptors are in Benzoic acid, 2-(4-morpholinylmethyl)-, lithium salt(1:1)?
There are 4 hydrogen bond acceptors in the compound.
What is the topological polar surface area of Benzoic acid, 2-(4-morpholinylmethyl)-, lithium salt(1:1)?
The topological polar surface area is 52.6 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.