What is the molecular formula of N,N-Dimethyl(2-hydroxyethyl)ammonium propionate?
The molecular formula is C7H17NO3.
What is the molecular weight of N,N-Dimethyl(2-hydroxyethyl)ammonium propionate?
The molecular weight is 163.21 g/mol.
What are some synonyms for N,N-Dimethyl(2-hydroxyethyl)ammonium propionate?
Some synonyms include 90434-46-1, N,N-Dimethylethanolammonium propionate, and propanoic acid 2-(dimethylamino)ethanol.
What is the IUPAC name of N,N-Dimethyl(2-hydroxyethyl)ammonium propionate?
The IUPAC name is 2-(dimethylamino)ethanol; propanoic acid.
What is the InChI of N,N-Dimethyl(2-hydroxyethyl)ammonium propionate?
The InChI is InChI=1S/C4H11NO.C3H6O2/c1-5(2)3-4-6;1-2-3(4)5/h6H,3-4H2,1-2H3;2H2,1H3,(H,4,5).
What is the InChIKey of N,N-Dimethyl(2-hydroxyethyl)ammonium propionate?
The InChIKey is DWLUNFAUNAHQIY-UHFFFAOYSA-N.
How many hydrogen bond donor counts does N,N-Dimethyl(2-hydroxyethyl)ammonium propionate have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does N,N-Dimethyl(2-hydroxyethyl)ammonium propionate have?
It has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does N,N-Dimethyl(2-hydroxyethyl)ammonium propionate have?
It has 3 rotatable bond counts.
What is the topological polar surface area of N,N-Dimethyl(2-hydroxyethyl)ammonium propionate?
The topological polar surface area is 60.8?2.