904328-95-6 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H13N.
The molecular weight of the compound is 171.24 g/mol.
The IUPAC name of the compound is 3-(3-methylbut-3-enyl)benzonitrile.
The InChIKey of the compound is KCXUVSZVSWWVGE-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CC(=C)CCC1=CC(=CC=C1)C#N.
The XLogP3-AA value of the compound is 3.6.
The compound has 0 hydrogen bond donor count.
The exact mass of the compound is 171.104799419 g/mol.
The compound has 3 rotatable bond count.
Yes, the compound is canonicalized.