90389-40-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The PubChem CID of the compound is 457579.
The molecular formula of the compound is C10H14FN.
The CAS number of the compound is 90389-87-0.
The IUPAC name of the compound is N-[(3-fluorophenyl)methyl]propan-2-amine.
The computed InChI of the compound is InChI=1S/C10H14FN/c1-8(2)12-7-9-4-3-5-10(11)6-9/h3-6,8,12H,7H2,1-2H3.
The molecular weight of the compound is 167.22 g/mol.
The XLogP3 value of the compound is 2.5.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The compound has 3 rotatable bond counts.