CAS
9036-15-1 Purity
---
9036-15-1 Purity
---
Inquiry Basket
3H-Pyrrolo[4,3,2-gh]-1,4-benzodiazonin-3-one,1,2,4,5,6,8-hexahydro-5-(hydroxymethyl)-1-methyl-2-(1-methylethyl)-,(2S,5S)-
CAS
90365-57-4
Catalog Number
ACM90365574
Category
Other Products
Molecular Weight
301.3834
Molecular Formula
C17H23N3O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of (-)-indolactam V?
The molecular formula of (-)-indolactam V is C17H23N3O2.
What is the molecular weight of (-)-indolactam V?
The molecular weight of (-)-indolactam V is 301.4 g/mol.
What is the IUPAC Name of (-)-indolactam V?
The IUPAC Name of (-)-indolactam V is (10S,13S)-13-(hydroxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.0 4,15 ]pentadeca-1,4(15),5,7-tetraen-11-one.
What is the Canonical SMILES of (-)-indolactam V?
The Canonical SMILES of (-)-indolactam V is CC(C)C1C(=O)NC(CC2=CNC3=C2C(=CC=C3)N1C)CO.
What is the InChIKey of (-)-indolactam V?
The InChIKey of (-)-indolactam V is LUZOFMGZMUZSSK-LRDDRELGSA-N.
What is the CAS number of (-)-indolactam V?
The CAS number of (-)-indolactam V is 90365-57-4.
What is the hydrogen bond donor count of (-)-indolactam V?
The hydrogen bond donor count of (-)-indolactam V is 3.
What is the hydrogen bond acceptor count of (-)-indolactam V?
The hydrogen bond acceptor count of (-)-indolactam V is 3.
What is the topological polar surface area of (-)-indolactam V?
The topological polar surface area of (-)-indolactam V is 68.4 Ų.
How many defined atom stereocenters are present in (-)-indolactam V?
(-)-indolactam V has 2 defined atom stereocenters.
Recommended Products
