903549-49-5 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H8Cl3N.
The molecular weight of the compound is 224.5 g/mol.
The IUPAC name of the compound is 4,6-dichloro-2,3-dihydro-1H-indole;hydrochloride.
The InChI of the compound is InChI=1S/C8H7Cl2N.ClH/c9-5-3-7(10)6-1-2-11-8(6)4-5;/h3-4,11H,1-2H2;1H.
The InChIKey of the compound is RREOOKIQVLLQMO-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CNC2=C1C(=CC(=C2)Cl)Cl.Cl.
The CAS number of the compound is 903551-23-5.
The hydrogen bond donor count of the compound is 2.
The hydrogen bond acceptor count of the compound is 1.
Yes, the compound is canonicalized.