9025-84-7 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H10N2O4.
The molecular weight of the compound is 246.22 g/mol.
The IUPAC name of the compound is 2-(1,3-benzodioxol-5-yl)-5-methyl-1H-imidazole-4-carboxylic acid.
The InChI of the compound is InChI=1S/C12H10N2O4/c1-6-10(12(15)16)14-11(13-6)7-2-3-8-9(4-7)18-5-17-8/h2-4H,5H2,1H3,(H,13,14)(H,15,16).
The InChIKey of the compound is MZHPZXDTAPQVDZ-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=C(N=C(N1)C2=CC3=C(C=C2)OCO3)C(=O)O.
The CAS number of the compound is 902600-40-2.
The ChEMBL ID of the compound is CHEMBL1540427.
The hydrogen bond donor count of the compound is 2.
Yes, the compound is canonicalized.