90197-83-4 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C19H14N4O2S.
The IUPAC name of the compound is N-(1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)-1-oxo-2H-isoquinoline-3-carboxamide.
The InChI of the compound is InChI=1S/C19H14N4O2S/c24-17-13-4-2-1-3-11(13)9-14(22-17)18(25)21-12-5-6-16-15(10-12)23-8-7-20-19(23)26-16/h1-6,9-10H,7-8H2,(H,21,25)(H,22,24).
The InChIKey of the compound is RPKWAIFDCGLTCY-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CN2C3=C(C=CC(=C3)NC(=O)C4=CC5=CC=CC=C5C(=O)N4)SC2=N1.
The molecular weight of the compound is 362.4 g/mol.
The XLogP3-AA value of the compound is 2.
The compound has 2 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.
The compound has 2 rotatable bond counts.