CAS
901924-78-5 Purity
---
901924-78-5 Purity
---
Inquiry Basket
2-Methyl-6-chlorobenzenesulfonamide
CAS
90196-33-1
Catalog Number
ACM90196331
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Methyl-6-chlorobenzenesulfonamide?
The molecular formula of 2-Methyl-6-chlorobenzenesulfonamide is C7H8ClNO2S.
What is the molecular weight of 2-Methyl-6-chlorobenzenesulfonamide?
The molecular weight of 2-Methyl-6-chlorobenzenesulfonamide is 205.66 g/mol.
What is the IUPAC name of 2-Methyl-6-chlorobenzenesulfonamide?
The IUPAC name of 2-Methyl-6-chlorobenzenesulfonamide is 2-chloro-6-methylbenzenesulfonamide.
What is the InChIKey of 2-Methyl-6-chlorobenzenesulfonamide?
The InChIKey of 2-Methyl-6-chlorobenzenesulfonamide is RPYMTSUCKIJOAK-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 2-Methyl-6-chlorobenzenesulfonamide?
The Canonical SMILES representation of 2-Methyl-6-chlorobenzenesulfonamide is CC1=C(C(=CC=C1)Cl)S(=O)(=O)N.
What is the XLogP3-AA value of 2-Methyl-6-chlorobenzenesulfonamide?
The XLogP3-AA value of 2-Methyl-6-chlorobenzenesulfonamide is 1.5.
How many hydrogen bond donor counts are there in 2-Methyl-6-chlorobenzenesulfonamide?
There is one hydrogen bond donor count in 2-Methyl-6-chlorobenzenesulfonamide.
How many hydrogen bond acceptor counts are there in 2-Methyl-6-chlorobenzenesulfonamide?
There are three hydrogen bond acceptor counts in 2-Methyl-6-chlorobenzenesulfonamide.
What is the topological polar surface area of 2-Methyl-6-chlorobenzenesulfonamide?
The topological polar surface area of 2-Methyl-6-chlorobenzenesulfonamide is 68.5 Ų.
Is 2-Methyl-6-chlorobenzenesulfonamide a canonicalized compound?
Yes, 2-Methyl-6-chlorobenzenesulfonamide is a canonicalized compound according to PubChem.
Recommended Products
CAS
901927-72-8 Purity
---
901927-72-8 Purity
---
![1-Azabicyclo[2.2.2]oct-2-ene-2-carboxamide(7ci)](https://resource.alfa-chemistry.com/structure/90196-93-3.gif)
