9001-89-2 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H11N3O.
The synonyms of the compound are 90019-55-9, 5-Methyl-2-phenyl-pyrazolo[1,5-a]pyrimidin-7-ol, 5-methyl-2-phenylpyrazolo[1,5-a]pyrimidin-7-ol, 5-methyl-2-phenylpyrazolo[1,5-a]pyrimidin-7(4H)-one, and 65774-92-7.
The molecular weight of the compound is 225.25 g/mol.
The IUPAC name of the compound is 5-methyl-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
The InChI of the compound is InChI=1S/C13H11N3O/c1-9-7-13(17)16-12(14-9)8-11(15-16)10-5-3-2-4-6-10/h2-8,15H,1H3.
The InChIKey of the compound is ABYPHBKOHUMAEP-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=CC(=O)N2C(=N1)C=C(N2)C3=CC=CC=C3.
The XLogP3-AA value of the compound is 1.7.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.