CAS
9001-84-7 Purity
96 %. (HPLC, amino acid analysis)
9001-84-7 Purity
96 %. (HPLC, amino acid analysis)
Inquiry Basket
5-Nitro-1-cyclohexene-1-carboxaldehyde
CAS
900186-75-6
Catalog Number
ACM900186756
Category
Other Products
Molecular Formula
C7H9NO3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-nitrocyclohexene-1-carbaldehyde.
What is the molecular formula of the compound?
The molecular formula of the compound is C7H9NO3.
What is the molecular weight of the compound?
The molecular weight of the compound is 155.15 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H9NO3/c9-5-6-2-1-3-7(4-6)8(10)11/h2,5,7H,1,3-4H2.
What is the InChIKey of the compound?
The InChIKey of the compound is NPMCLDQNMQFCPS-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1CC(CC(=C1)C=O)[N+](=O)[O-].
What is the CAS number of the compound?
The CAS number of the compound is 900186-75-6.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.8.
How many hydrogen bond donor count does the compound have?
The compound has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does the compound have?
The compound has 3 hydrogen bond acceptor count.
Recommended Products
