What is the molecular formula of 1-(tert-Butoxycarbonyl)-5,5-dimethylpyrrolidine-2-carboxylic acid?
The molecular formula is C12H21NO4.
What are the synonyms of 1-(tert-Butoxycarbonyl)-5,5-dimethylpyrrolidine-2-carboxylic acid?
Some synonyms include 900158-99-8, 1-BOC-5,5-dimethylpyrrolidine-2-carboxylic acid, and more.
What is the molecular weight of 1-(tert-Butoxycarbonyl)-5,5-dimethylpyrrolidine-2-carboxylic acid?
The molecular weight is 243.30 g/mol.
What is the InChIKey of 1-(tert-Butoxycarbonyl)-5,5-dimethylpyrrolidine-2-carboxylic acid?
The InChIKey is SFPBDVPSCZYAHV-UHFFFAOYSA-N.
What is the canonical SMILES representation of 1-(tert-Butoxycarbonyl)-5,5-dimethylpyrrolidine-2-carboxylic acid?
The canonical SMILES representation is CC1(CCC(N1C(=O)OC(C)(C)C)C(=O)O)C.
How many hydrogen bond donor count does 1-(tert-Butoxycarbonyl)-5,5-dimethylpyrrolidine-2-carboxylic acid have?
It has one hydrogen bond donor count.
What is the exact mass of 1-(tert-Butoxycarbonyl)-5,5-dimethylpyrrolidine-2-carboxylic acid?
The exact mass is 243.14705815 g/mol.
What is the formal charge of 1-(tert-Butoxycarbonyl)-5,5-dimethylpyrrolidine-2-carboxylic acid?
The formal charge is 0.
How many rotatable bond counts does 1-(tert-Butoxycarbonyl)-5,5-dimethylpyrrolidine-2-carboxylic acid have?
It has 3 rotatable bond counts.
Is 1-(tert-Butoxycarbonyl)-5,5-dimethylpyrrolidine-2-carboxylic acid a canonicalized compound?
Yes, it is a canonicalized compound.