90607-21-9 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of 3,5-Dichloro-2-hydroxybenzaldehyde is C7H4Cl2O2.
The molecular weight of 3,5-Dichloro-2-hydroxybenzaldehyde is 191.01 g/mol.
The IUPAC name of 3,5-Dichloro-2-hydroxybenzaldehyde is 3,5-dichloro-2-hydroxybenzaldehyde.
The InChI of 3,5-Dichloro-2-hydroxybenzaldehyde is InChI=1S/C7H4Cl2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H.
The InChIKey of 3,5-Dichloro-2-hydroxybenzaldehyde is FABVMBDCVAJXMB-UHFFFAOYSA-N.
The canonical SMILES of 3,5-Dichloro-2-hydroxybenzaldehyde is C1=C(C=C(C(=C1C=O)O)Cl)Cl.
The CAS number of 3,5-Dichloro-2-hydroxybenzaldehyde is 90-60-8.
The XLogP3-AA value of 3,5-Dichloro-2-hydroxybenzaldehyde is 2.8.
The hydrogen bond donor count of 3,5-Dichloro-2-hydroxybenzaldehyde is 1.