90206-23-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 4-Chloro-5-hydroxynaphthalene-2,7-disulphonic acid is C10H7ClO7S2.
The PubChem CID for 4-Chloro-5-hydroxynaphthalene-2,7-disulphonic acid was created on August 8, 2005.
The molecular weight of 4-Chloro-5-hydroxynaphthalene-2,7-disulphonic acid is 338.7 g/mol.
The Canonical SMILES representation of 4-Chloro-5-hydroxynaphthalene-2,7-disulphonic acid is C1=C2C=C(C=C(C2=C(C=C1S(=O)(=O)O)O)Cl)S(=O)(=O)O.
4-Chloro-5-hydroxynaphthalene-2,7-disulphonic acid has 3 hydrogen bond donor counts.
The topological polar surface area of 4-Chloro-5-hydroxynaphthalene-2,7-disulphonic acid is 146 Å2.
There are 2 rotatable bond counts in 4-Chloro-5-hydroxynaphthalene-2,7-disulphonic acid.
The InChIKey for 4-Chloro-5-hydroxynaphthalene-2,7-disulphonic acid is PGAVDCUYQQGYAK-UHFFFAOYSA-N.
4-Chloro-5-hydroxynaphthalene-2,7-disulphonic acid has 7 hydrogen bond acceptor counts.
Yes, 4-Chloro-5-hydroxynaphthalene-2,7-disulphonic acid is considered a canonicalized compound.