CAS
89978-84-7 Purity
97%
89978-84-7 Purity
97%
Inquiry Basket
Guanidine,[2-(1-piperazinyl)ethyl]-(7ci)
CAS
89980-08-5
Catalog Number
ACM89980085
Category
Other Products
Molecular Formula
C7H17N5
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(2-piperazin-1-ylethyl)guanidine.
What is the molecular formula of the compound?
The molecular formula of the compound is C7H17N5.
What is the molecular weight of the compound?
The molecular weight of the compound is 171.24 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H17N5/c8-7(9)11-3-6-12-4-1-10-2-5-12/h10H,1-6H2,(H4,8,9,11).
What is the InChIKey of the compound?
The InChIKey of the compound is XHIGUBZMTKFOQP-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1CN(CCN1)CCN=C(N)N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is -1.9.
How many hydrogen bond donor counts does the compound have?
The compound has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 3 rotatable bond counts.
Recommended Products
CAS
899793-52-3 Purity
---
899793-52-3 Purity
---
