CAS
898791-22-5 Purity
96%
898791-22-5 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C13H14Cl2O3.
The molecular weight is 289.15 g/mol.
The IUPAC name is 7-(2,4-dichlorophenyl)-7-oxoheptanoic acid.
The Canonical SMILES is C1=CC(=C(C=C1Cl)Cl)C(=O)CCCCCC(=O)O.
The CAS number is 898791-25-8.
The XLogP3-AA value is 3.5.
It has 1 hydrogen bond donor count.
The exact mass is 288.0319997 g/mol.
The topological polar surface area is 54.4 2.
Yes, the compound is canonicalized.