What is the molecular formula of 2-Amino-5-bromo-3-trifluoromethylpyridine?
The molecular formula is C6H4BrF3N2.
What is the molecular weight of 2-Amino-5-bromo-3-trifluoromethylpyridine?
The molecular weight is 241.01 g/mol.
When was 2-Amino-5-bromo-3-trifluoromethylpyridine created on PubChem?
It was created on December 5, 2007.
What is the IUPAC name of 2-Amino-5-bromo-3-trifluoromethylpyridine?
The IUPAC name is 5-bromo-3-(trifluoromethyl)pyridin-2-amine.
What is the InChI of 2-Amino-5-bromo-3-trifluoromethylpyridine?
The InChI is InChI=1S/C6H4BrF3N2/c7-3-1-4(6(8,9)10)5(11)12-2-3/h1-2H,(H2,11,12).
What is the Canonical SMILES of 2-Amino-5-bromo-3-trifluoromethylpyridine?
The Canonical SMILES is C1=C(C=NC(=C1C(F)(F)F)N)Br.
What is the CAS number of 2-Amino-5-bromo-3-trifluoromethylpyridine?
The CAS number is 79456-34-1.
How many hydrogen bond acceptor counts does 2-Amino-5-bromo-3-trifluoromethylpyridine have?
It has 5 hydrogen bond acceptor counts.
What is the topological polar surface area of 2-Amino-5-bromo-3-trifluoromethylpyridine?
The topological polar surface area is 38.9 Ų.
Is 2-Amino-5-bromo-3-trifluoromethylpyridine a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.