596-88-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The PubChem CID of the compound is 80083.
The molecular formula of the compound is C18H18N4.
The molecular weight of the compound is 290.4 g/mol.
The IUPAC name of the compound is 4-N,4-N-bis(4-aminophenyl)benzene-1,4-diamine.
The InChI of the compound is InChI=1S/C18H18N4/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H,19-21H2.
The InChIKey of the compound is SNLFYGIUTYKKOE-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC=C1N)N(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N.
The CAS number of the compound is 5981-09-9.
The European Community (EC) number of the compound is 227-791-7.
Yes, the compound is canonicalized.