1-((Diiodomethyl)sulfonyl)-4-methylbenzene

CAS

20018-09-1

Catalog Number

ACM20018091

Category

Main Products

Molecular Weight

422.02

Molecular Formula

C8H8I2O2S

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene?

The molecular formula of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene is C8H8I2O2S.

What are the synonyms of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene?

The synonyms of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene include Diiodomethyl p-tolyl sulfone, Tolyl diiodomethyl sulfone, and 1-(diiodomethylsulfonyl)-4-methylbenzene.

What is the molecular weight of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene?

The molecular weight of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene is 422.02 g/mol.

What is the IUPAC name of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene?

The IUPAC name of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene is 1-(diiodomethylsulfonyl)-4-methylbenzene.

What is the InChI of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene?

The InChI of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene is InChI=1S/C8H8I2O2S/c1-6-2-4-7(5-3-6)13(11,12)8(9)10/h2-5,8H,1H3.

What is the InChIKey of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene?

The InChIKey of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene is XOILGBPDXMVFIP-UHFFFAOYSA-N.

What is the canonical SMILES of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene?

The canonical SMILES of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene is CC1=CC=C(C=C1)S(=O)(=O)C(I)I.

What is the CAS number of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene?

The CAS number of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene is 20018-09-1.

What is the boiling point of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene?

The boiling point of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene is 394 °C.

What is the melting point of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene?

The melting point of 1-((Diiodomethyl)sulfonyl)-4-methylbenzene is 136 °C (range of 149-152 °C).