17075-14-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C11H21N3O5.
Some synonyms are 17105-15-6, epsilon-(gamma-Glutamyl)-lysine, epsilon-(gamma-L-Glutamyl)lysine, epsilon-(gamma-L-Glutamyl)-L-lysine.
The molecular weight is 275.30 g/mol.
The chemical structure can be viewed at the following link: https://pubchem.ncbi.nlm.nih.gov/image/imgsrv.fcgi?cid=7015685&t=l
The IUPAC name is (2S)-2-amino-6-[[(4S)-4-amino-4-carboxybutanoyl]amino]hexanoic acid.
The InChI is InChI=1S/C11H21N3O5/c12-7(10(16)17)3-1-2-6-14-9(15)5-4-8(13)11(18)19/h7-8H,1-6,12-13H2,(H,14,15)(H,16,17)(H,18,19)/t7-,8-/m0/s1.
The InChIKey is JPKNLFVGUZRHOB-YUMQZZPRSA-N.
The CAS number is 17105-15-6.
Some computed properties include the molecular weight, XLogP3-AA, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, covalently-bonded unit count, and canonicalization.
It is described as a solid.