CAS
497165-15-8 Purity
97+%
497165-15-8 Purity
97+%
Inquiry Basket
2-Isobutoxypyridine-3-boronicacid
CAS
1218790-95-4
Catalog Number
ACM1218790954-1
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Isobutoxypyridine-3-boronic acid?
The molecular formula of 2-Isobutoxypyridine-3-boronic acid is C9H14BNO3.
What is the molecular weight of 2-Isobutoxypyridine-3-boronic acid?
The molecular weight of 2-Isobutoxypyridine-3-boronic acid is 195.03 g/mol.
What is the IUPAC name of 2-Isobutoxypyridine-3-boronic acid?
The IUPAC name of 2-Isobutoxypyridine-3-boronic acid is [2-(2-methylpropoxy)pyridin-3-yl]boronic acid.
What is the InChI of 2-Isobutoxypyridine-3-boronic acid?
The InChI of 2-Isobutoxypyridine-3-boronic acid is InChI=1S/C9H14BNO3/c1-7(2)6-14-9-8(10(12)13)4-3-5-11-9/h3-5,7,12-13H,6H2,1-2H3.
What is the InChIKey of 2-Isobutoxypyridine-3-boronic acid?
The InChIKey of 2-Isobutoxypyridine-3-boronic acid is VMPOWUYMVMJUSI-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Isobutoxypyridine-3-boronic acid?
The canonical SMILES of 2-Isobutoxypyridine-3-boronic acid is B(C1=C(N=CC=C1)OCC(C)C)(O)O.
What is the CAS number of 2-Isobutoxypyridine-3-boronic acid?
The CAS number of 2-Isobutoxypyridine-3-boronic acid is 1218790-95-4.
What is the hydrogen bond donor count of 2-Isobutoxypyridine-3-boronic acid?
The hydrogen bond donor count of 2-Isobutoxypyridine-3-boronic acid is 2.
What is the hydrogen bond acceptor count of 2-Isobutoxypyridine-3-boronic acid?
The hydrogen bond acceptor count of 2-Isobutoxypyridine-3-boronic acid is 4.
Is 2-Isobutoxypyridine-3-boronic acid a canonicalized compound?
Yes, 2-Isobutoxypyridine-3-boronic acid is a canonicalized compound.
Recommended Products
