Tropisetron hydrochloride

CAS

105826-92-4

Catalog Number

ACM105826924

Category

Other Products

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of Tropisetron Hydrochloride?

The molecular formula of Tropisetron Hydrochloride is C17H21ClN2O2.

What is the molecular weight of Tropisetron Hydrochloride?

The molecular weight of Tropisetron Hydrochloride is 320.8 g/mol.

What is the CAS number of Tropisetron Hydrochloride?

The CAS number of Tropisetron Hydrochloride is 105826-92-4.

What is the IUPAC name of Tropisetron Hydrochloride?

The IUPAC name of Tropisetron Hydrochloride is [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 1H-indole-3-carboxylate;hydrochloride.

What is the InChI of Tropisetron Hydrochloride?

The InChI of Tropisetron Hydrochloride is InChI=1S/C17H20N2O2.ClH/c1-19-11-6-7-12(19)9-13 (8-11)21-17(20)15-10-18-16-5-3-2-4-14(15)16;/h2-5,10-13,18H,6-9H2,1H3;1H/t11-,12+,13?.

What are the synonyms of Tropisetron Hydrochloride?

The synonyms of Tropisetron Hydrochloride are Tropisetron hydrochloride, 105826-92-4, TROPISETRON HCl, Tropisetron monohydrochloride.

What is the role of Tropisetron Hydrochloride?

Tropisetron Hydrochloride has multiple roles including anti-inflammatory agent, antiemetic, apoptosis inhibitor, immunomodulator, neuroprotective agent, nicotinic acetylcholine receptor agonist, serotonergic antagonist, and trypanocidal drug.

What is the function of Tropisetron Hydrochloride as a medication?

Tropisetron Hydrochloride is used for the prevention of nausea and vomiting, particularly induced by chemotherapy and radiotherapy.

What is the mechanism of action of Tropisetron Hydrochloride?

Tropisetron Hydrochloride competitively binds to and blocks the action of serotonin at 5HT3 receptors in the gastrointestinal tract and the chemoreceptor trigger zone of the central nervous system, resulting in the suppression of nausea and vomiting.

Recommended Products