CAS
1356087-58-5 Purity
---
1356087-58-5 Purity
---
Inquiry Basket
6-(Piperidin-1-yl)pyridine-3-boronicacid
CAS
1002129-33-0
Catalog Number
ACM1002129330-1
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C10H15BN2O2.
What is the molecular weight of the compound?
The molecular weight of the compound is 206.05 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (6-piperidin-1-ylpyridin-3-yl)boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H15BN2O2/c14-11(15)9-4-5-10(12-8-9)13-6-2-1-3-7-13/h4-5,8,14-15H,1-3,6-7H2.
What is the InChIKey of the compound?
The InChIKey of the compound is FPXBTJSTSXJJBK-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=CN=C(C=C1)N2CCCCC2)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 1002129-33-0.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 56.6Ų.
Recommended Products
