99260-66-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of Bismuth(III) gallate basic hydrate is C7H8BiO7.
The molecular weight of Bismuth(III) gallate basic hydrate is 413.11 g/mol.
The InChI of Bismuth(III) gallate basic hydrate is InChI=1S/C7H6O5.Bi.2H2O/c8-4-1-3(7(11)12)2-5(9)6(4)10;;;/h1-2,8-10H,(H,11,12);;2*1H2/q;+2;;/p-2.
The InChIKey of Bismuth(III) gallate basic hydrate is QYRZNUWUKYCZNU-UHFFFAOYSA-L.
The Canonical SMILES of Bismuth(III) gallate basic hydrate is C1=C(C=C2C(=C1O)O[Bi]O2)C(=O)O.O.O.
Bismuth(III) gallate basic hydrate has 4 hydrogen bond donor counts.
Bismuth(III) gallate basic hydrate has 7 hydrogen bond acceptor counts.
Bismuth(III) gallate basic hydrate has 1 rotatable bond count.
The exact mass of Bismuth(III) gallate basic hydrate is 413.00740 g/mol.
Yes, Bismuth(III) gallate basic hydrate is a canonicalized compound.