Bis[(2-diphenylphosphino)ethyl]ammonium chloride

• CAS: 66534-97-2
• Catalog Number: ACM66534972
• Category: Amines
• Molecular Weight: 477.95
• Molecular Formula: C₂₄H₂₂NO₂P
• Hazard Statements: H302-H315-H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of Bis[(2-diphenylphosphino)ethyl]ammonium chloride?

The molecular formula of Bis[(2-diphenylphosphino)ethyl]ammonium chloride is C28H30ClNP2.

What is the molecular weight of Bis[(2-diphenylphosphino)ethyl]ammonium chloride?

The molecular weight of Bis[(2-diphenylphosphino)ethyl]ammonium chloride is 477.9 g/mol.

What are the synonyms of Bis[(2-diphenylphosphino)ethyl]ammonium chloride?

The synonyms of Bis[(2-diphenylphosphino)ethyl]ammonium chloride include 66534-97-2, Bis(2-(diphenylphosphino)ethyl)amine hydrochloride, and more.

What is the IUPAC name of Bis[(2-diphenylphosphino)ethyl]ammonium chloride?

The IUPAC name of Bis[(2-diphenylphosphino)ethyl]ammonium chloride is 2-diphenylphosphanyl-N-(2-diphenylphosphanylethyl)ethanamine;hydrochloride.

What is the InChIKey for Bis[(2-diphenylphosphino)ethyl]ammonium chloride?

The InChIKey for Bis[(2-diphenylphosphino)ethyl]ammonium chloride is AVDUVHMGGDOIQI-UHFFFAOYSA-N.

What is the Canonical SMILES representation of Bis[(2-diphenylphosphino)ethyl]ammonium chloride?

The Canonical SMILES representation of Bis[(2-diphenylphosphino)ethyl]ammonium chloride is C1=CC=C(C=C1)P(CCNCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl.

What is the CAS number of Bis[(2-diphenylphosphino)ethyl]ammonium chloride?

The CAS number of Bis[(2-diphenylphosphino)ethyl]ammonium chloride is 66534-97-2.

How many hydrogen bond donor counts does Bis[(2-diphenylphosphino)ethyl]ammonium chloride have?

Bis[(2-diphenylphosphino)ethyl]ammonium chloride has 2 hydrogen bond donor counts.

What is the exact mass of Bis[(2-diphenylphosphino)ethyl]ammonium chloride?

The exact mass of Bis[(2-diphenylphosphino)ethyl]ammonium chloride is 477.1542017 g/mol.

Is Bis[(2-diphenylphosphino)ethyl]ammonium chloride a canonicalized compound?

Yes, Bis[(2-diphenylphosphino)ethyl]ammonium chloride is a canonicalized compound.