Bicyclo[4.1.0]heptane-7-carboxylic acid

• Catalog Number: ACMA00000555
• Category: Alkanes
• Molecular Weight: 140.18
• Molecular Formula: C₈H₁₉O₄P
• Hazard Statements: H315-H319-H335
• RIDADR: UN 2263 3 / PGII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of Bicyclo[4.1.0]heptane-7-carboxylic acid?

The molecular formula of Bicyclo[4.1.0]heptane-7-carboxylic acid is C8H12O2.

What is the molecular weight of Bicyclo[4.1.0]heptane-7-carboxylic acid?

The molecular weight of Bicyclo[4.1.0]heptane-7-carboxylic acid is 140.18 g/mol.

What is the IUPAC name of Bicyclo[4.1.0]heptane-7-carboxylic acid?

The IUPAC name of Bicyclo[4.1.0]heptane-7-carboxylic acid is bicyclo[4.1.0]heptane-7-carboxylic acid.

What is the InChI of Bicyclo[4.1.0]heptane-7-carboxylic acid?

The InChI of Bicyclo[4.1.0]heptane-7-carboxylic acid is InChI=1S/C8H12O2/c9-8(10)7-5-3-1-2-4-6(5)7/h5-7H,1-4H2,(H,9,10).

What is the InChIKey of Bicyclo[4.1.0]heptane-7-carboxylic acid?

The InChIKey of Bicyclo[4.1.0]heptane-7-carboxylic acid is PNTAWGJKWLLAAW-UHFFFAOYSA-N.

What is the canonical SMILES of Bicyclo[4.1.0]heptane-7-carboxylic acid?

The canonical SMILES of Bicyclo[4.1.0]heptane-7-carboxylic acid is C1CCC2C(C1)C2C(=O)O.

What is the CAS number of Bicyclo[4.1.0]heptane-7-carboxylic acid?

The CAS number of Bicyclo[4.1.0]heptane-7-carboxylic acid is 41894-76-2.

How many hydrogen bond donor counts does Bicyclo[4.1.0]heptane-7-carboxylic acid have?

Bicyclo[4.1.0]heptane-7-carboxylic acid has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does Bicyclo[4.1.0]heptane-7-carboxylic acid have?

Bicyclo[4.1.0]heptane-7-carboxylic acid has 2 hydrogen bond acceptor counts.