841296-15-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of Anthraquinone-1-diazonium chloride is C14H7ClN2O2.
Anthraquinone-1-diazonium chloride was created in PubChem on 2005-07-19.
The molecular weight of Anthraquinone-1-diazonium chloride is 270.67 g/mol.
Anthraquinone-1-diazonium chloride has 4 Hydrogen Bond Acceptor Count.
The InChIKey of Anthraquinone-1-diazonium chloride is QAJMZRMIUJJTBN-UHFFFAOYSA-M.
The Canonical SMILES representation of Anthraquinone-1-diazonium chloride is C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)[N+]#N.[Cl-].
The CAS number of Anthraquinone-1-diazonium chloride is 16048-37-6.
There are 2 covalently-bonded units in Anthraquinone-1-diazonium chloride.
No, Anthraquinone-1-diazonium chloride does not have any Defined Atom Stereocenter Count.
Yes, Anthraquinone-1-diazonium chloride is the canonicalized form.