Alpha,alpha,alpha,alpha,alpha,alpha-hexamethylbenzene-1,3,5-trimethanol

• CAS: 19576-38-6
• Catalog Number: ACM19576386
• Category: Other Products
• Molecular Weight: 252.34926
• Molecular Formula: C₁₅H₂₄O₃
• Synonyms: alpha,alpha,alpha,alpha,alpha,alpha-hexamethylbenzene-1,3,5-trimethanol ;2,2,2-(Benzene-1,3,5-triyl)tris(2-propanol);Benzene-1,3,5-triyltris(α,α-dimethylmethanol);α,α,α,α,α,α-Hexamethyl-1,3,5-benzenetrimethanol;α,α,α,α,α,α-Hexamethylbenzene-1,3,5-trismethanol

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-[3,5-bis(2-hydroxypropan-2-yl)phenyl]propan-2-ol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C15H24O3/c1-13(2,16)10-7-11(14(3,4)17)9-12(8-10)15(5,6)18/h7-9,16-18H,1-6H3.

What is the InChIKey of the compound?

The InChIKey of the compound is FMCWGKXGRNQNLD-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC(C)(C1=CC(=CC(=C1)C(C)(C)O)C(C)(C)O)O.

What is the molecular weight of the compound?

The molecular weight of the compound is 252.35 g/mol.

What is the CAS number of the compound?

The CAS number of the compound is 19576-38-6.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 243-166-1.

How many hydrogen bond donor count does the compound have?

The compound has 3 hydrogen bond donor count.

How many hydrogen bond acceptor count does the compound have?

The compound has 3 hydrogen bond acceptor count.

How many rotatable bond count does the compound have?

The compound has 3 rotatable bond count.