7-Chloro-4-methoxy-1H-pyrrolo[2,3-c]pyridine hydrochloride

• CAS: 917918-83-3
• Catalog Number: ACM917918833
• Category: Pyridines
• Molecular Weight: 219.07
• Molecular Formula: C8H8Cl2N2O

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C8H8Cl2N2O.

What are the synonyms for the compound?

The synonyms for the compound include 917918-83-3, 7-chloro-4-methoxy-1H-pyrrolo[2,3-c]pyridine hydrochloride, and 7-Chloro-4-methoxypyrrolo[2,3-c]pyridine Hydrochloride.

What is the molecular weight of the compound?

The molecular weight of the compound is 219.06 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 7-chloro-4-methoxy-1H-pyrrolo[2,3-c]pyridine;hydrochloride.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C8H7ClN2O.ClH/c1-12-6-4-11-8(9)7-5(6)2-3-10-7;/h2-4,10H,1H3;1H.

What is the InChIKey of the compound?

The InChIKey of the compound is DFHHUZGTJHWRNJ-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is COC1=CN=C(C2=C1C=CN2)Cl.Cl.

How many hydrogen bond donor counts does the compound have?

The compound has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 37.9?2.