7-Bromo-4-hydroxy-3-nitroquinoline

• CAS: 723280-94-2
• Catalog Number: ACM723280942
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 7-Bromo-4-hydroxy-3-nitroquinoline?

The molecular formula is C9H5BrN2O3.

What is the molecular weight of 7-Bromo-4-hydroxy-3-nitroquinoline?

The molecular weight is 269.05 g/mol.

What is the IUPAC name of 7-Bromo-4-hydroxy-3-nitroquinoline?

The IUPAC name is 7-bromo-3-nitro-1H-quinolin-4-one.

What is the InChI of 7-Bromo-4-hydroxy-3-nitroquinoline?

The InChI is InChI=1S/C9H5BrN2O3/c10-5-1-2-6-7(3-5)11-4-8(9(6)13)12(14)15/h1-4H,(H,11,13).

What is the InChIKey of 7-Bromo-4-hydroxy-3-nitroquinoline?

The InChIKey is QJMLADCOCGDUQT-UHFFFAOYSA-N.

What is the canonical SMILES of 7-Bromo-4-hydroxy-3-nitroquinoline?

The canonical SMILES is C1=CC2=C(C=C1Br)NC=C(C2=O)[N+](=O)[O-].

What is the CAS number of 7-Bromo-4-hydroxy-3-nitroquinoline?

The CAS number is 723280-94-2.

What is the European Community (EC) Number of 7-Bromo-4-hydroxy-3-nitroquinoline?

The European Community (EC) Number is 829-646-9.

What is the XLogP3-AA value of 7-Bromo-4-hydroxy-3-nitroquinoline?

The XLogP3-AA value is 2.3.

Is 7-Bromo-4-hydroxy-3-nitroquinoline a canonicalized compound?

Yes, 7-Bromo-4-hydroxy-3-nitroquinoline is a canonicalized compound.