6Beta-hydroxyestrone

• CAS: 1229-25-0
• Catalog Number: ACM1229250
• Category: Steroidal Compounds
• Molecular Weight: 286.37
• Molecular Formula: C₁₈H₂₂O₃
• Synonyms: (6β)-3,6-Dihydroxyestra-1,3,5(10)-trien-17-one; 3,6β-Dihydroxyestra-1,3,5(10)-trien-17-one; 6β-Hydroxyestrone
• IUPAC Name: (6R,8R,9S,13S,14S)-3,6-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one
• SMILES: CC12CCC3C(C1CCC2=O)CC(C4=C3C=CC(=C4)O)O
• InChI Key: HTORTGVWUGQTHQ-UHOVARLQSA-N
• Exact Mass: 286.15700

Custom Q&A

What is the molecular formula of 6beta-hydroxyestrone?

The molecular formula of 6beta-hydroxyestrone is C18H22O3.

What is the molecular weight of 6beta-hydroxyestrone?

The molecular weight of 6beta-hydroxyestrone is 286.4 g/mol.

What is the IUPAC name of 6beta-hydroxyestrone?

The IUPAC name of 6beta-hydroxyestrone is (6R,8R,9S,13S,14S)-3,6-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.

What is the CAS number of 6beta-hydroxyestrone?

The CAS number of 6beta-hydroxyestrone is 1229-25-0.

How many hydrogen bond donor counts does 6beta-hydroxyestrone have?

6beta-hydroxyestrone has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 6beta-hydroxyestrone have?

6beta-hydroxyestrone has 3 hydrogen bond acceptor counts.

What is the exact mass of 6beta-hydroxyestrone?

The exact mass of 6beta-hydroxyestrone is 286.15689456 g/mol.

What is the topological polar surface area of 6beta-hydroxyestrone?

The topological polar surface area of 6beta-hydroxyestrone is 57.5Ų.

How many defined atom stereocenter counts does 6beta-hydroxyestrone have?

6beta-hydroxyestrone has 5 defined atom stereocenter counts.

Does 6beta-hydroxyestrone have any undefined atom stereocenter count?

No, 6beta-hydroxyestrone does not have any undefined atom stereocenter count.