6-(Piperazin-1-yl)pyridine-2-boronicacidpinacolester

CAS

1309981-38-1

Catalog Number

ACM1309981381

Category

Boronic Esters

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the PubChem CID of the compound?

The PubChem CID of the compound is 45786335.

What is the molecular formula of the compound?

The molecular formula of the compound is C15H24BN3O2.

What are some synonyms of the compound?

Some synonyms of the compound are 1309981-38-1, 1-(6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)piperazine, 1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]piperazine, 6-(Piperazin-1-yl)pyridine-2-boronic acid pinacol ester, and DTXSID80671333.

What is the molecular weight of the compound?

The molecular weight of the compound is 289.18 g/mol.

When was the compound created and modified?

The compound was created on June 21, 2010, and modified on December 2, 2023.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]piperazine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C15H24BN3O2/c1-14(2)15(3,4)21-16(20-14)12-6-5-7-13(18-12)19-10-8-17-9-11-19/h5-7,17H,8-11H2,1-4H3.

What is the InChIKey of the compound?

The InChIKey of the compound is JKMFZLYCHPGXEZ-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)N3CCNCC3.