CAS
1084953-47-8 Purity
---
1084953-47-8 Purity
---
Inquiry Basket
6-(Imidazol-1-yl)pyridine-2-boronicacidpinacolester
CAS
1163706-77-1
Catalog Number
ACM1163706771
Category
Boronic Esters
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C14H18BN3O2.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-imidazol-1-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
What is the InChIKey of the compound?
The InChIKey of the compound is QABHFJLOSGQKKY-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)N3C=CN=C3.
What is the molecular weight of the compound?
The molecular weight of the compound is 271.12 g/mol.
How many hydrogen bond donor atoms does the compound have?
The compound has 0 hydrogen bond donor atoms.
How many hydrogen bond acceptor atoms does the compound have?
The compound has 4 hydrogen bond acceptor atoms.
How many rotatable bonds are present in the compound?
The compound has 2 rotatable bonds.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 49.2 Ų.
How many heavy atoms are present in the compound?
The compound has 20 heavy atoms.
Recommended Products
![1H-Pyrazolo[3,4-B]pyridine-5-boronicacidpinacolester](https://resource.alfa-chemistry.com/structure/1093819-50-1.gif)
CAS
1073353-51-1 Purity
---
1073353-51-1 Purity
---
CAS
1264162-23-3 Purity
---
1264162-23-3 Purity
---
