CAS
1309982-37-3 Purity
---
1309982-37-3 Purity
---
Inquiry Basket
6-(Ethyl(methyl)amino)pyridin-2-ylboronic acid
CAS
1264153-68-5
Catalog Number
ACM1264153685
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is [6-[ethyl(methyl)amino]pyridin-2-yl]boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H13BN2O2/c1-3-11(2)8-6-4-5-7(10-8)9(12)13/h4-6,12-13H,3H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is PTSLTPQDFFYKEN-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=NC(=CC=C1)N(C)CC)(O)O.
What is the molecular weight of the compound?
The molecular weight of the compound is 180.01 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does the molecule have?
The molecule has 3 rotatable bond counts.
What is the exact mass of the compound?
The exact mass of the compound is 180.1070078 g/mol.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![5-([tert-Butyl(dimethyl)silyl]oxy)pyridine-3-boronicacid](https://resource.alfa-chemistry.com/structure/1309982-37-3.gif)
CAS
380430-55-7 Purity
98%
380430-55-7 Purity
98%
