CAS
1032758-80-7 Purity
---
1032758-80-7 Purity
---
Inquiry Basket
6-(Cyclohexylamino)pyridine-2-boronicacidpinacolester
CAS
1315350-19-6
Catalog Number
ACM1315350196
Category
Boronic Esters
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C17H27BN2O2.
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-cyclohexyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C17H27BN2O2/c1-16(2)17(3,4)22-18(21-16)14-11-8-12-15(20-14)19-13-9-6-5-7-10-13/h8,11-13H,5-7,9-10H2,1-4H3,(H,19,20).
What is the InChIKey of the compound?
The InChIKey of the compound is AUSZJUACMJASTN-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)NC3CCCCC3.
What is the CAS number of the compound?
The CAS number of the compound is 1315350-19-6.
What is the molecular weight of the compound?
The molecular weight of the compound is 302.2 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 43.4Ų.
Recommended Products
CAS
1032758-88-5 Purity
---
1032758-88-5 Purity
---
CAS
1257431-63-2 Purity
---
1257431-63-2 Purity
---
